C23H25N3O4 — CID 8932617
ethyl 2-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-4-methylquinoline-3-carboxylate (PubChem CID 8932617) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is ethyl 2-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-4-methylquinoline-3-carboxylate.
| Compound Name | ethyl 2-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-4-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 8932617 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | ethyl 2-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-4-methylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(CN2CCN(C(=O)c3ccco3)CC2)nc2ccccc2c1C |
| InChI | InChI=1S/C23H25N3O4/c1-3-29-23(28)21-16(2)17-7-4-5-8-18(17)24-19(21)15-25-10-12-26(13-11-25)22(27)20-9-6-14-30-20/h4-9,14H,3,10-13,15H2,1-2H3 |
| InChIKey | OKMBQAQLHPHMMY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |