C26H19N3O3 — CID 18198896
methyl 2-[(4-oxoquinazolin-3-yl)methyl]-4-phenylquinoline-3-carboxylate (PubChem CID 18198896) has the molecular formula C26H19N3O3 and a molecular weight of 421.46 g/mol. Its IUPAC name is methyl 2-[(4-oxoquinazolin-3-yl)methyl]-4-phenylquinoline-3-carboxylate.
| Compound Name | methyl 2-[(4-oxoquinazolin-3-yl)methyl]-4-phenylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 18198896 |
| Molecular Formula | C26H19N3O3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | methyl 2-[(4-oxoquinazolin-3-yl)methyl]-4-phenylquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(Cn2cnc3ccccc3c2=O)nc2ccccc2c1-c1ccccc1 |
| InChI | InChI=1S/C26H19N3O3/c1-32-26(31)24-22(15-29-16-27-20-13-7-6-12-19(20)25(29)30)28-21-14-8-5-11-18(21)23(24)17-9-3-2-4-10-17/h2-14,16H,15H2,1H3 |
| InChIKey | GODXFBZINXLOFM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |