C18H24BN3O4 — CID 171809812
[7-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]quinolin-4-yl]boronic acid (PubChem CID 171809812) has the molecular formula C18H24BN3O4 and a molecular weight of 357.22 g/mol. Its IUPAC name is [7-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]quinolin-4-yl]boronic acid.
| Compound Name | [7-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]quinolin-4-yl]boronic acid |
|---|---|
| PubChem CID | 171809812 |
| Molecular Formula | C18H24BN3O4 |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | [7-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]quinolin-4-yl]boronic acid |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc3c(B(O)O)ccnc3c2)CC1 |
| InChI | InChI=1S/C18H24BN3O4/c1-18(2,3)26-17(23)22-10-8-21(9-11-22)13-4-5-14-15(19(24)25)6-7-20-16(14)12-13/h4-7,12,24-25H,8-11H2,1-3H3 |
| InChIKey | JNUWTJVKMPIKJN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 86.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|