C26H40N4O3Si — CID 58078504
tert-butyl (3R,4R)-4-methyl-3-[10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]piperidine-1-carboxylate (PubChem CID 58078504) has the molecular formula C26H40N4O3Si and a molecular weight of 484.72 g/mol. Its IUPAC name is tert-butyl (3R,4R)-4-methyl-3-[10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-4-methyl-3-[10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58078504 |
| Molecular Formula | C26H40N4O3Si |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | tert-butyl (3R,4R)-4-methyl-3-[10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]piperidine-1-carboxylate |
| SMILES | C[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@@H]1n1ccc2cnc3c(ccn3COCC[Si](C)(C)C)c21 |
| InChI | InChI=1S/C26H40N4O3Si/c1-19-8-11-28(25(31)33-26(2,3)4)17-22(19)30-13-9-20-16-27-24-21(23(20)30)10-12-29(24)18-32-14-15-34(5,6)7/h9-10,12-13,16,19,22H,8,11,14-15,17-18H2,1-7H3/t19-,22+/m1/s1 |
| InChIKey | OPZUTDJPZZIDFD-KNQAVFIVSA-N |
| XLogP | 6.12 |
| TPSA | 61.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|