C27H41N5O3SSi — CID 155634625
tert-butyl (3R)-3-[[5-(2-methyl-1,3-thiazol-5-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 155634625) has the molecular formula C27H41N5O3SSi and a molecular weight of 543.81 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[5-(2-methyl-1,3-thiazol-5-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[5-(2-methyl-1,3-thiazol-5-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155634625 |
| Molecular Formula | C27H41N5O3SSi |
| Molecular Weight | 543.81 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | tert-butyl (3R)-3-[[5-(2-methyl-1,3-thiazol-5-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | Cc1ncc(-c2cnc3c(ccn3COCC[Si](C)(C)C)c2N[C@@H]2CCCN(C(=O)OC(C)(C)C)C2)s1 |
| InChI | InChI=1S/C27H41N5O3SSi/c1-19-28-16-23(36-19)22-15-29-25-21(10-12-32(25)18-34-13-14-37(5,6)7)24(22)30-20-9-8-11-31(17-20)26(33)35-27(2,3)4/h10,12,15-16,20H,8-9,11,13-14,17-18H2,1-7H3,(H,29,30)/t20-/m1/s1 |
| InChIKey | NQRHJVSWEVYLOR-HXUWFJFHSA-N |
| XLogP | 6.59 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.81 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|