C22H36BrN5O3Si — CID 140780943
tert-butyl (3R)-3-[[5-bromo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 140780943) has the molecular formula C22H36BrN5O3Si and a molecular weight of 526.55 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[5-bromo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[5-bromo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140780943 |
| Molecular Formula | C22H36BrN5O3Si |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | tert-butyl (3R)-3-[[5-bromo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](Nc2ncnc3c2c(Br)cn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C22H36BrN5O3Si/c1-22(2,3)31-21(29)27-9-7-8-16(12-27)26-19-18-17(23)13-28(20(18)25-14-24-19)15-30-10-11-32(4,5)6/h13-14,16H,7-12,15H2,1-6H3,(H,24,25,26)/t16-/m1/s1 |
| InChIKey | YDQACJMIIXCXOR-MRXNPFEDSA-N |
| XLogP | 5.32 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|