C29H41BrF3N5O3Si — CID 170547777
tert-butyl (3S)-3-[[4-[7-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)-2H-pyrimidin-1-yl]amino]piperidine-1-carboxylate (PubChem CID 170547777) has the molecular formula C29H41BrF3N5O3Si and a molecular weight of 672.66 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[4-[7-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)-2H-pyrimidin-1-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[4-[7-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)-2H-pyrimidin-1-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170547777 |
| Molecular Formula | C29H41BrF3N5O3Si |
| Molecular Weight | 672.66 g/mol |
| Exact Mass | 671.21 |
| IUPAC Name | tert-butyl (3S)-3-[[4-[7-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)-2H-pyrimidin-1-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](NN2C=C(C(F)(F)F)C(c3cn(COCC[Si](C)(C)C)c4c(Br)cccc34)=NC2)C1 |
| InChI | InChI=1S/C29H41BrF3N5O3Si/c1-28(2,3)41-27(39)36-12-8-9-20(15-36)35-38-17-23(29(31,32)33)25(34-18-38)22-16-37(19-40-13-14-42(4,5)6)26-21(22)10-7-11-24(26)30/h7,10-11,16-17,20,35H,8-9,12-15,18-19H2,1-6H3/t20-/m0/s1 |
| InChIKey | OFAKINXVAKLVNZ-FQEVSTJZSA-N |
| XLogP | 7.13 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.66 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|