C29H39IN6O3Si — CID 167376030
tert-butyl (3S)-3-[[5-iodo-4-[6-isocyano-1-(2-trimethylsilylethoxymethyl)indol-3-yl]pyrimidin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 167376030) has the molecular formula C29H39IN6O3Si and a molecular weight of 674.66 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[5-iodo-4-[6-isocyano-1-(2-trimethylsilylethoxymethyl)indol-3-yl]pyrimidin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[5-iodo-4-[6-isocyano-1-(2-trimethylsilylethoxymethyl)indol-3-yl]pyrimidin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167376030 |
| Molecular Formula | C29H39IN6O3Si |
| Molecular Weight | 674.66 g/mol |
| Exact Mass | 674.19 |
| IUPAC Name | tert-butyl (3S)-3-[[5-iodo-4-[6-isocyano-1-(2-trimethylsilylethoxymethyl)indol-3-yl]pyrimidin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | [C-]#[N+]c1ccc2c(-c3nc(N[C@H]4CCCN(C(=O)OC(C)(C)C)C4)ncc3I)cn(COCC[Si](C)(C)C)c2c1 |
| InChI | InChI=1S/C29H39IN6O3Si/c1-29(2,3)39-28(37)35-12-8-9-21(17-35)33-27-32-16-24(30)26(34-27)23-18-36(19-38-13-14-40(5,6)7)25-15-20(31-4)10-11-22(23)25/h10-11,15-16,18,21H,8-9,12-14,17,19H2,1-3,5-7H3,(H,32,33,34)/t21-/m0/s1 |
| InChIKey | LWMLAILHAMUPDN-NRFANRHFSA-N |
| XLogP | 7.38 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.66 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|