C26H34BrN5O3Si — CID 142751826
[[4-[7-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-ethenylpyrimidin-2-yl]amino] piperidine-1-carboxylate (PubChem CID 142751826) has the molecular formula C26H34BrN5O3Si and a molecular weight of 572.58 g/mol. Its IUPAC name is [[4-[7-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-ethenylpyrimidin-2-yl]amino] piperidine-1-carboxylate.
| Compound Name | [[4-[7-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-ethenylpyrimidin-2-yl]amino] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142751826 |
| Molecular Formula | C26H34BrN5O3Si |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | [[4-[7-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-ethenylpyrimidin-2-yl]amino] piperidine-1-carboxylate |
| SMILES | C=Cc1cnc(NOC(=O)N2CCCCC2)nc1-c1cn(COCC[Si](C)(C)C)c2c(Br)cccc12 |
| InChI | InChI=1S/C26H34BrN5O3Si/c1-5-19-16-28-25(30-35-26(33)31-12-7-6-8-13-31)29-23(19)21-17-32(18-34-14-15-36(2,3)4)24-20(21)10-9-11-22(24)27/h5,9-11,16-17H,1,6-8,12-15,18H2,2-4H3,(H,28,29,30) |
| InChIKey | WWNKISSLVWHNAH-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|