C25H39ClN6O5Si — CID 171839823
tert-butyl 4-[[5-chloro-4-[3-methoxycarbonyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyrimidin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 171839823) has the molecular formula C25H39ClN6O5Si and a molecular weight of 567.16 g/mol. Its IUPAC name is tert-butyl 4-[[5-chloro-4-[3-methoxycarbonyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyrimidin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[5-chloro-4-[3-methoxycarbonyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyrimidin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171839823 |
| Molecular Formula | C25H39ClN6O5Si |
| Molecular Weight | 567.16 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | tert-butyl 4-[[5-chloro-4-[3-methoxycarbonyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyrimidin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | COC(=O)c1nn(COCC[Si](C)(C)C)cc1-c1nc(NC2CCN(C(=O)OC(C)(C)C)CC2)ncc1Cl |
| InChI | InChI=1S/C25H39ClN6O5Si/c1-25(2,3)37-24(34)31-10-8-17(9-11-31)28-23-27-14-19(26)20(29-23)18-15-32(30-21(18)22(33)35-4)16-36-12-13-38(5,6)7/h14-15,17H,8-13,16H2,1-7H3,(H,27,28,29) |
| InChIKey | DMQXTXNZTQLZKT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.16 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|