C17H20BrN3O4Si — CID 175080684
2-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-1,3-oxazole-4-carboxylic acid (PubChem CID 175080684) has the molecular formula C17H20BrN3O4Si and a molecular weight of 438.35 g/mol. Its IUPAC name is 2-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 175080684 |
| Molecular Formula | C17H20BrN3O4Si |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 2-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-1,3-oxazole-4-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2nc(C(=O)O)co2)c2cc(Br)cnc21 |
| InChI | InChI=1S/C17H20BrN3O4Si/c1-26(2,3)5-4-24-10-21-8-13(12-6-11(18)7-19-15(12)21)16-20-14(9-25-16)17(22)23/h6-9H,4-5,10H2,1-3H3,(H,22,23) |
| InChIKey | FZXPXLSEELUBRN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|