C24H27BrF3N3O2Si — CID 170548659
[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-[2,6-difluoro-3-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]methanone (PubChem CID 170548659) has the molecular formula C24H27BrF3N3O2Si and a molecular weight of 554.48 g/mol. Its IUPAC name is [5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-[2,6-difluoro-3-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]methanone.
| Compound Name | [5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-[2,6-difluoro-3-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]methanone |
|---|---|
| PubChem CID | 170548659 |
| Molecular Formula | C24H27BrF3N3O2Si |
| Molecular Weight | 554.48 g/mol |
| Exact Mass | 553.10 |
| IUPAC Name | [5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-[2,6-difluoro-3-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]methanone |
| SMILES | C[Si](C)(C)CCOCn1cc(C(=O)c2c(F)ccc(N3CC[C@@H](F)C3)c2F)c2cc(Br)cnc21 |
| InChI | InChI=1S/C24H27BrF3N3O2Si/c1-34(2,3)9-8-33-14-31-13-18(17-10-15(25)11-29-24(17)31)23(32)21-19(27)4-5-20(22(21)28)30-7-6-16(26)12-30/h4-5,10-11,13,16H,6-9,12,14H2,1-3H3/t16-/m1/s1 |
| InChIKey | FQODNTVPMNOQHZ-MRXNPFEDSA-N |
| XLogP | 6.17 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.48 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|