C27H24ClF2N3O4S — CID 144584183
[5-(4-chlorophenyl)-3-[2,6-difluoro-3-(propylsulfanylamino)benzoyl]pyrrolo[2,3-b]pyridin-1-yl]methyl ethyl carbonate (PubChem CID 144584183) has the molecular formula C27H24ClF2N3O4S and a molecular weight of 560.02 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-3-[2,6-difluoro-3-(propylsulfanylamino)benzoyl]pyrrolo[2,3-b]pyridin-1-yl]methyl ethyl carbonate.
| Compound Name | [5-(4-chlorophenyl)-3-[2,6-difluoro-3-(propylsulfanylamino)benzoyl]pyrrolo[2,3-b]pyridin-1-yl]methyl ethyl carbonate |
|---|---|
| PubChem CID | 144584183 |
| Molecular Formula | C27H24ClF2N3O4S |
| Molecular Weight | 560.02 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | [5-(4-chlorophenyl)-3-[2,6-difluoro-3-(propylsulfanylamino)benzoyl]pyrrolo[2,3-b]pyridin-1-yl]methyl ethyl carbonate |
| SMILES | CCCSNc1ccc(F)c(C(=O)c2cn(COC(=O)OCC)c3ncc(-c4ccc(Cl)cc4)cc23)c1F |
| InChI | InChI=1S/C27H24ClF2N3O4S/c1-3-11-38-32-22-10-9-21(29)23(24(22)30)25(34)20-14-33(15-37-27(35)36-4-2)26-19(20)12-17(13-31-26)16-5-7-18(28)8-6-16/h5-10,12-14,32H,3-4,11,15H2,1-2H3 |
| InChIKey | PCDDHLKTRHZTEN-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.02 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|