C26H24ClF2N3O2S — CID 142402685
[5-(2-chloro-4-propoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[2,6-difluoro-3-(propylsulfanylamino)phenyl]methanone (PubChem CID 142402685) has the molecular formula C26H24ClF2N3O2S and a molecular weight of 516.01 g/mol. Its IUPAC name is [5-(2-chloro-4-propoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[2,6-difluoro-3-(propylsulfanylamino)phenyl]methanone.
| Compound Name | [5-(2-chloro-4-propoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[2,6-difluoro-3-(propylsulfanylamino)phenyl]methanone |
|---|---|
| PubChem CID | 142402685 |
| Molecular Formula | C26H24ClF2N3O2S |
| Molecular Weight | 516.01 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | [5-(2-chloro-4-propoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[2,6-difluoro-3-(propylsulfanylamino)phenyl]methanone |
| SMILES | CCCOc1ccc(-c2cnc3[nH]cc(C(=O)c4c(F)ccc(NSCCC)c4F)c3c2)c(Cl)c1 |
| InChI | InChI=1S/C26H24ClF2N3O2S/c1-3-9-34-16-5-6-17(20(27)12-16)15-11-18-19(14-31-26(18)30-13-15)25(33)23-21(28)7-8-22(24(23)29)32-35-10-4-2/h5-8,11-14,32H,3-4,9-10H2,1-2H3,(H,30,31) |
| InChIKey | FWXLLRQGJWCNFJ-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.01 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|