C24H19ClF2N3O4S- — CID 135248901
5-[2-chloro-4-[(2-methylpropan-2-yl)oxy]phenyl]-3-[2,6-difluoro-3-(sulfinatoamino)benzoyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 135248901) has the molecular formula C24H19ClF2N3O4S- and a molecular weight of 518.95 g/mol. Its IUPAC name is 5-[2-chloro-4-[(2-methylpropan-2-yl)oxy]phenyl]-3-[2,6-difluoro-3-(sulfinatoamino)benzoyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-[2-chloro-4-[(2-methylpropan-2-yl)oxy]phenyl]-3-[2,6-difluoro-3-(sulfinatoamino)benzoyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 135248901 |
| Molecular Formula | C24H19ClF2N3O4S- |
| Molecular Weight | 518.95 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | 5-[2-chloro-4-[(2-methylpropan-2-yl)oxy]phenyl]-3-[2,6-difluoro-3-(sulfinatoamino)benzoyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC(C)(C)Oc1ccc(-c2cnc3[nH]cc(C(=O)c4c(F)ccc(NS(=O)[O-])c4F)c3c2)c(Cl)c1 |
| InChI | InChI=1S/C24H20ClF2N3O4S/c1-24(2,3)34-13-4-5-14(17(25)9-13)12-8-15-16(11-29-23(15)28-10-12)22(31)20-18(26)6-7-19(21(20)27)30-35(32)33/h4-11,30H,1-3H3,(H,28,29)(H,32,33)/p-1 |
| InChIKey | YBAACXXGXFUDPW-UHFFFAOYSA-M |
| XLogP | 5.78 |
| TPSA | 107.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.95 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|