C23H18ClF2N3OS — CID 169229407
[5-(4-chlorophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[2,4-difluoro-3-(propylsulfanylamino)phenyl]methanone (PubChem CID 169229407) has the molecular formula C23H18ClF2N3OS and a molecular weight of 457.93 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[2,4-difluoro-3-(propylsulfanylamino)phenyl]methanone.
| Compound Name | [5-(4-chlorophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[2,4-difluoro-3-(propylsulfanylamino)phenyl]methanone |
|---|---|
| PubChem CID | 169229407 |
| Molecular Formula | C23H18ClF2N3OS |
| Molecular Weight | 457.93 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | [5-(4-chlorophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[2,4-difluoro-3-(propylsulfanylamino)phenyl]methanone |
| SMILES | CCCSNc1c(F)ccc(C(=O)c2c[nH]c3ncc(-c4ccc(Cl)cc4)cc23)c1F |
| InChI | InChI=1S/C23H18ClF2N3OS/c1-2-9-31-29-21-19(25)8-7-16(20(21)26)22(30)18-12-28-23-17(18)10-14(11-27-23)13-3-5-15(24)6-4-13/h3-8,10-12,29H,2,9H2,1H3,(H,27,28) |
| InChIKey | GAWGOAJPTFFUOF-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.93 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|