C26H26F2N4OS — CID 155591824
[5-(4-tert-butylphenyl)-2H-pyrazolo[3,4-b]pyridin-3-yl]-[2,4-difluoro-3-(propylsulfanylamino)phenyl]methanone (PubChem CID 155591824) has the molecular formula C26H26F2N4OS and a molecular weight of 480.58 g/mol. Its IUPAC name is [5-(4-tert-butylphenyl)-2H-pyrazolo[3,4-b]pyridin-3-yl]-[2,4-difluoro-3-(propylsulfanylamino)phenyl]methanone.
| Compound Name | [5-(4-tert-butylphenyl)-2H-pyrazolo[3,4-b]pyridin-3-yl]-[2,4-difluoro-3-(propylsulfanylamino)phenyl]methanone |
|---|---|
| PubChem CID | 155591824 |
| Molecular Formula | C26H26F2N4OS |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | [5-(4-tert-butylphenyl)-2H-pyrazolo[3,4-b]pyridin-3-yl]-[2,4-difluoro-3-(propylsulfanylamino)phenyl]methanone |
| SMILES | CCCSNc1c(F)ccc(C(=O)c2[nH]nc3ncc(-c4ccc(C(C)(C)C)cc4)cc23)c1F |
| InChI | InChI=1S/C26H26F2N4OS/c1-5-12-34-32-23-20(27)11-10-18(21(23)28)24(33)22-19-13-16(14-29-25(19)31-30-22)15-6-8-17(9-7-15)26(2,3)4/h6-11,13-14,32H,5,12H2,1-4H3,(H,29,30,31) |
| InChIKey | BFBHSAKPRMRLRH-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|