C15H25F2NO2S2 — CID 153376281
2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol (PubChem CID 153376281) has the molecular formula C15H25F2NO2S2 and a molecular weight of 353.50 g/mol. Its IUPAC name is 2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol.
| Compound Name | 2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol |
|---|---|
| PubChem CID | 153376281 |
| Molecular Formula | C15H25F2NO2S2 |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol |
| SMILES | CC.CCCS.CCCSNc1c(F)ccc(C(=O)O)c1F |
| InChI | InChI=1S/C10H11F2NO2S.C3H8S.C2H6/c1-2-5-16-13-9-7(11)4-3-6(8(9)12)10(14)15;1-2-3-4;1-2/h3-4,13H,2,5H2,1H3,(H,14,15);4H,2-3H2,1H3;1-2H3 |
| InChIKey | UVVQTTJWOOFJAY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|