About 2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol
2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol (PubChem CID 153376281) has the molecular formula C15H25F2NO2S2
and a molecular weight of 353.50 g/mol. Its IUPAC name is 2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol.
Molecular Properties
| Compound Name | 2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol |
| PubChem CID | 153376281 |
| Molecular Formula | C15H25F2NO2S2 |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol |
| SMILES | CC.CCCS.CCCSNc1c(F)ccc(C(=O)O)c1F |
| InChI | InChI=1S/C10H11F2NO2S.C3H8S.C2H6/c1-2-5-16-13-9-7(11)4-3-6(8(9)12)10(14)15;1-2-3-4;1-2/h3-4,13H,2,5H2,1H3,(H,14,15);4H,2-3H2,1H3;1-2H3 |
| InChIKey | UVVQTTJWOOFJAY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol?
The IUPAC name of 2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol (CID 153376281) is 2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol.
What is the SMILES notation for 2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol?
The canonical SMILES for 2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol is CC.CCCS.CCCSNc1c(F)ccc(C(=O)O)c1F.
What is the InChIKey of 2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol?
The InChIKey is UVVQTTJWOOFJAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO2S.C3H8S.C2H6/c1-2-5-16-13-9-7(11)4-3-6(8(9)12)10(14)15;1-2-3-4;1-2/h3-4,13H,2,5H2,1H3,(H,14,15);4H,2-3H2,1H3;1-2H3.
What are the key properties of 2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol?
2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol has a molecular weight of 353.50 g/mol, XLogP of 5.49, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-3-(propylsulfanylamino)benzoic acid;ethane;propane-1-thiol is sourced from PubChem (CID 153376281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).