C10H10ClF2NOS — CID 153394408
2,6-difluoro-3-(propylsulfanylamino)benzoyl chloride (PubChem CID 153394408) has the molecular formula C10H10ClF2NOS and a molecular weight of 265.71 g/mol. Its IUPAC name is 2,6-difluoro-3-(propylsulfanylamino)benzoyl chloride.
| Compound Name | 2,6-difluoro-3-(propylsulfanylamino)benzoyl chloride |
|---|---|
| PubChem CID | 153394408 |
| Molecular Formula | C10H10ClF2NOS |
| Molecular Weight | 265.71 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 2,6-difluoro-3-(propylsulfanylamino)benzoyl chloride |
| SMILES | CCCSNc1ccc(F)c(C(=O)Cl)c1F |
| InChI | InChI=1S/C10H10ClF2NOS/c1-2-5-16-14-7-4-3-6(12)8(9(7)13)10(11)15/h3-4,14H,2,5H2,1H3 |
| InChIKey | UMAQEVQCZFBTIO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.71 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|