C9H6F5NO2S — CID 162557674
2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid (PubChem CID 162557674) has the molecular formula C9H6F5NO2S and a molecular weight of 287.21 g/mol. Its IUPAC name is 2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid.
| Compound Name | 2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid |
|---|---|
| PubChem CID | 162557674 |
| Molecular Formula | C9H6F5NO2S |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid |
| SMILES | O=C(O)c1c(F)ccc(NSCC(F)(F)F)c1F |
| InChI | InChI=1S/C9H6F5NO2S/c10-4-1-2-5(7(11)6(4)8(16)17)15-18-3-9(12,13)14/h1-2,15H,3H2,(H,16,17) |
| InChIKey | RKQSSMJSXFMBQI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|