2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid

C9H6F5NO2S — CID 162557674

IUPAC2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid
SMILESO=C(O)c1c(F)ccc(NSCC(F)(F)F)c1F
InChIInChI=1S/C9H6F5NO2S/c10-4-1-2-5(7(11)6(4)8(16)17)15-18-3-9(12,13)14/h1-2,15H,3H2,(H,16,17)
InChIKeyRKQSSMJSXFMBQI-UHFFFAOYSA-N
MW287.21 g/mol
LogP3.29
Rot. Bonds4

About 2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid

2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid (PubChem CID 162557674) has the molecular formula C9H6F5NO2S and a molecular weight of 287.21 g/mol. Its IUPAC name is 2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid.

Molecular Properties

Compound Name2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid
PubChem CID162557674
Molecular FormulaC9H6F5NO2S
Molecular Weight287.21 g/mol
Exact Mass287.00
IUPAC Name2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid
SMILESO=C(O)c1c(F)ccc(NSCC(F)(F)F)c1F
InChIInChI=1S/C9H6F5NO2S/c10-4-1-2-5(7(11)6(4)8(16)17)15-18-3-9(12,13)14/h1-2,15H,3H2,(H,16,17)
InChIKeyRKQSSMJSXFMBQI-UHFFFAOYSA-N
XLogP3.29
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.21
LogP ≤ 53.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid?
The IUPAC name of 2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid (CID 162557674) is 2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid.
What is the SMILES notation for 2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid?
The canonical SMILES for 2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid is O=C(O)c1c(F)ccc(NSCC(F)(F)F)c1F.
What is the InChIKey of 2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid?
The InChIKey is RKQSSMJSXFMBQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F5NO2S/c10-4-1-2-5(7(11)6(4)8(16)17)15-18-3-9(12,13)14/h1-2,15H,3H2,(H,16,17).
What are the key properties of 2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid?
2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid has a molecular weight of 287.21 g/mol, XLogP of 3.29, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluoro-3-(2,2,2-trifluoroethylsulfanylamino)benzoic acid is sourced from PubChem (CID 162557674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).