C10H11F2NO3S — CID 137483384
2,6-difluoro-3-(propylsulfinylamino)benzoic acid (PubChem CID 137483384) has the molecular formula C10H11F2NO3S and a molecular weight of 263.26 g/mol. Its IUPAC name is 2,6-difluoro-3-(propylsulfinylamino)benzoic acid.
| Compound Name | 2,6-difluoro-3-(propylsulfinylamino)benzoic acid |
|---|---|
| PubChem CID | 137483384 |
| Molecular Formula | C10H11F2NO3S |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2,6-difluoro-3-(propylsulfinylamino)benzoic acid |
| SMILES | CCCS(=O)Nc1ccc(F)c(C(=O)O)c1F |
| InChI | InChI=1S/C10H11F2NO3S/c1-2-5-17(16)13-7-4-3-6(11)8(9(7)12)10(14)15/h3-4,13H,2,5H2,1H3,(H,14,15) |
| InChIKey | QSKJNSUFEQRENJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |