C12H17ClFNO2S — CID 143384163
6-chloro-2-fluoro-3-(propylsulfanylamino)benzoic acid;ethane (PubChem CID 143384163) has the molecular formula C12H17ClFNO2S and a molecular weight of 293.79 g/mol. Its IUPAC name is 6-chloro-2-fluoro-3-(propylsulfanylamino)benzoic acid;ethane.
| Compound Name | 6-chloro-2-fluoro-3-(propylsulfanylamino)benzoic acid;ethane |
|---|---|
| PubChem CID | 143384163 |
| Molecular Formula | C12H17ClFNO2S |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 6-chloro-2-fluoro-3-(propylsulfanylamino)benzoic acid;ethane |
| SMILES | CC.CCCSNc1ccc(Cl)c(C(=O)O)c1F |
| InChI | InChI=1S/C10H11ClFNO2S.C2H6/c1-2-5-16-13-7-4-3-6(11)8(9(7)12)10(14)15;1-2/h3-4,13H,2,5H2,1H3,(H,14,15);1-2H3 |
| InChIKey | RIOCAFFSWXVHDQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|