C6H2Cl2FNO2 — CID 11009178
2,5-dichloro-3-fluoropyridine-4-carboxylic acid (PubChem CID 11009178) has the molecular formula C6H2Cl2FNO2 and a molecular weight of 209.99 g/mol. Its IUPAC name is 2,5-dichloro-3-fluoropyridine-4-carboxylic acid.
| Compound Name | 2,5-dichloro-3-fluoropyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 11009178 |
| Molecular Formula | C6H2Cl2FNO2 |
| Molecular Weight | 209.99 g/mol |
| Exact Mass | 208.94 |
| IUPAC Name | 2,5-dichloro-3-fluoropyridine-4-carboxylic acid |
| SMILES | O=C(O)c1c(Cl)cnc(Cl)c1F |
| InChI | InChI=1S/C6H2Cl2FNO2/c7-2-1-10-5(8)4(9)3(2)6(11)12/h1H,(H,11,12) |
| InChIKey | XXKZEJNVNFYDAP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.99 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|