C8H3ClF4O3 — CID 10171499
6-chloro-2-fluoro-3-(trifluoromethoxy)benzoic acid (PubChem CID 10171499) has the molecular formula C8H3ClF4O3 and a molecular weight of 258.55 g/mol. Its IUPAC name is 6-chloro-2-fluoro-3-(trifluoromethoxy)benzoic acid.
| Compound Name | 6-chloro-2-fluoro-3-(trifluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 10171499 |
| Molecular Formula | C8H3ClF4O3 |
| Molecular Weight | 258.55 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | 6-chloro-2-fluoro-3-(trifluoromethoxy)benzoic acid |
| SMILES | O=C(O)c1c(Cl)ccc(OC(F)(F)F)c1F |
| InChI | InChI=1S/C8H3ClF4O3/c9-3-1-2-4(16-8(11,12)13)6(10)5(3)7(14)15/h1-2H,(H,14,15) |
| InChIKey | YDZVHUWUYZGSOQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |