C16H8F8O9 — CID 142516877
2-fluoro-6-[3-fluoro-4-(trifluoromethoxy)-2-(trihydroxymethoxy)phenoxy]-3-(trifluoromethoxy)benzoic acid (PubChem CID 142516877) has the molecular formula C16H8F8O9 and a molecular weight of 496.22 g/mol. Its IUPAC name is 2-fluoro-6-[3-fluoro-4-(trifluoromethoxy)-2-(trihydroxymethoxy)phenoxy]-3-(trifluoromethoxy)benzoic acid.
| Compound Name | 2-fluoro-6-[3-fluoro-4-(trifluoromethoxy)-2-(trihydroxymethoxy)phenoxy]-3-(trifluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 142516877 |
| Molecular Formula | C16H8F8O9 |
| Molecular Weight | 496.22 g/mol |
| Exact Mass | 496.00 |
| IUPAC Name | 2-fluoro-6-[3-fluoro-4-(trifluoromethoxy)-2-(trihydroxymethoxy)phenoxy]-3-(trifluoromethoxy)benzoic acid |
| SMILES | O=C(O)c1c(Oc2ccc(OC(F)(F)F)c(F)c2OC(O)(O)O)ccc(OC(F)(F)F)c1F |
| InChI | InChI=1S/C16H8F8O9/c17-10-6(31-14(19,20)21)2-1-5(9(10)13(25)26)30-8-4-3-7(32-15(22,23)24)11(18)12(8)33-16(27,28)29/h1-4,27-29H,(H,25,26) |
| InChIKey | NWBJBKMNDWIKGD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.22 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|