C8H7ClFN3O3 — CID 174162579
[6-chloro-5-fluoro-4-(methylcarbamoyl)-3-pyridinyl]carbamic acid (PubChem CID 174162579) has the molecular formula C8H7ClFN3O3 and a molecular weight of 247.61 g/mol. Its IUPAC name is [6-chloro-5-fluoro-4-(methylcarbamoyl)-3-pyridinyl]carbamic acid.
| Compound Name | [6-chloro-5-fluoro-4-(methylcarbamoyl)-3-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 174162579 |
| Molecular Formula | C8H7ClFN3O3 |
| Molecular Weight | 247.61 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | [6-chloro-5-fluoro-4-(methylcarbamoyl)-3-pyridinyl]carbamic acid |
| SMILES | CNC(=O)c1c(NC(=O)O)cnc(Cl)c1F |
| InChI | InChI=1S/C8H7ClFN3O3/c1-11-7(14)4-3(13-8(15)16)2-12-6(9)5(4)10/h2,13H,1H3,(H,11,14)(H,15,16) |
| InChIKey | OJUPLDHMEQMRSG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.61 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|