C12H13ClN2O2 — CID 141326546
[6-chloro-4-(3,3-dimethylbut-1-ynyl)-3-pyridinyl]carbamic acid (PubChem CID 141326546) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is [6-chloro-4-(3,3-dimethylbut-1-ynyl)-3-pyridinyl]carbamic acid.
| Compound Name | [6-chloro-4-(3,3-dimethylbut-1-ynyl)-3-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 141326546 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | [6-chloro-4-(3,3-dimethylbut-1-ynyl)-3-pyridinyl]carbamic acid |
| SMILES | CC(C)(C)C#Cc1cc(Cl)ncc1NC(=O)O |
| InChI | InChI=1S/C12H13ClN2O2/c1-12(2,3)5-4-8-6-10(13)14-7-9(8)15-11(16)17/h6-7,15H,1-3H3,(H,16,17) |
| InChIKey | WFDWFZYVWDGFPF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|