C10H16ClN3O — CID 153404933
2-[(2-chloro-5-methyl-4-pyridinyl)amino]acetamide;ethane (PubChem CID 153404933) has the molecular formula C10H16ClN3O and a molecular weight of 229.71 g/mol. Its IUPAC name is 2-[(2-chloro-5-methyl-4-pyridinyl)amino]acetamide;ethane.
| Compound Name | 2-[(2-chloro-5-methyl-4-pyridinyl)amino]acetamide;ethane |
|---|---|
| PubChem CID | 153404933 |
| Molecular Formula | C10H16ClN3O |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-[(2-chloro-5-methyl-4-pyridinyl)amino]acetamide;ethane |
| SMILES | CC.Cc1cnc(Cl)cc1NCC(N)=O |
| InChI | InChI=1S/C8H10ClN3O.C2H6/c1-5-3-12-7(9)2-6(5)11-4-8(10)13;1-2/h2-3H,4H2,1H3,(H2,10,13)(H,11,12);1-2H3 |
| InChIKey | CSIPUFDLLDPOPZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|