C9H14ClN — CID 144586230
2-chloro-4,5-dimethylpyridine;ethane (PubChem CID 144586230) has the molecular formula C9H14ClN and a molecular weight of 171.67 g/mol. Its IUPAC name is 2-chloro-4,5-dimethylpyridine;ethane.
| Compound Name | 2-chloro-4,5-dimethylpyridine;ethane |
|---|---|
| PubChem CID | 144586230 |
| Molecular Formula | C9H14ClN |
| Molecular Weight | 171.67 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 2-chloro-4,5-dimethylpyridine;ethane |
| SMILES | CC.Cc1cnc(Cl)cc1C |
| InChI | InChI=1S/C7H8ClN.C2H6/c1-5-3-7(8)9-4-6(5)2;1-2/h3-4H,1-2H3;1-2H3 |
| InChIKey | WZAPJCJXLJBTQE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.67 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|