C11H20ClN — CID 176713957
4-chloro-2,5-dimethylpyridine;ethane (PubChem CID 176713957) has the molecular formula C11H20ClN and a molecular weight of 201.74 g/mol. Its IUPAC name is 4-chloro-2,5-dimethylpyridine;ethane.
| Compound Name | 4-chloro-2,5-dimethylpyridine;ethane |
|---|---|
| PubChem CID | 176713957 |
| Molecular Formula | C11H20ClN |
| Molecular Weight | 201.74 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 4-chloro-2,5-dimethylpyridine;ethane |
| SMILES | CC.CC.Cc1cc(Cl)c(C)cn1 |
| InChI | InChI=1S/C7H8ClN.2C2H6/c1-5-4-9-6(2)3-7(5)8;2*1-2/h3-4H,1-2H3;2*1-2H3 |
| InChIKey | ZDAHUVBZQCVQSW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.74 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |