C10H20N2 — CID 143125119
2,5-dimethylpyrazine;ethane (PubChem CID 143125119) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 2,5-dimethylpyrazine;ethane.
| Compound Name | 2,5-dimethylpyrazine;ethane |
|---|---|
| PubChem CID | 143125119 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 2,5-dimethylpyrazine;ethane |
| SMILES | CC.CC.Cc1cnc(C)cn1 |
| InChI | InChI=1S/C6H8N2.2C2H6/c1-5-3-8-6(2)4-7-5;2*1-2/h3-4H,1-2H3;2*1-2H3 |
| InChIKey | ORWNSAMVAJSZHK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |