C10H7Cl2N — CID 169499833
5,7-dichloro-3-methylisoquinoline (PubChem CID 169499833) has the molecular formula C10H7Cl2N and a molecular weight of 212.08 g/mol. Its IUPAC name is 5,7-dichloro-3-methylisoquinoline.
| Compound Name | 5,7-dichloro-3-methylisoquinoline |
|---|---|
| PubChem CID | 169499833 |
| Molecular Formula | C10H7Cl2N |
| Molecular Weight | 212.08 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 5,7-dichloro-3-methylisoquinoline |
| SMILES | Cc1cc2c(Cl)cc(Cl)cc2cn1 |
| InChI | InChI=1S/C10H7Cl2N/c1-6-2-9-7(5-13-6)3-8(11)4-10(9)12/h2-5H,1H3 |
| InChIKey | XRHZSUSEJSYILC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.08 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |