C17H15Cl2N3O2 — CID 135179837
3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-methyl-2,6-naphthyridin-1-amine (PubChem CID 135179837) has the molecular formula C17H15Cl2N3O2 and a molecular weight of 364.23 g/mol. Its IUPAC name is 3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-methyl-2,6-naphthyridin-1-amine.
| Compound Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-methyl-2,6-naphthyridin-1-amine |
|---|---|
| PubChem CID | 135179837 |
| Molecular Formula | C17H15Cl2N3O2 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-methyl-2,6-naphthyridin-1-amine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(C)cc3c(N)n2)c1Cl |
| InChI | InChI=1S/C17H15Cl2N3O2/c1-8-4-10-9(7-21-8)5-11(22-17(10)20)14-15(18)12(23-2)6-13(24-3)16(14)19/h4-7H,1-3H3,(H2,20,22) |
| InChIKey | OPQPIMRLXKNUHX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |