C27H35Cl2N3O3 — CID 142381022
3-(2,6-dichloro-3,5-dimethoxyphenyl)-N,7-dimethyl-2,6-naphthyridin-1-amine;2-methylbut-2-ene;oxolane (PubChem CID 142381022) has the molecular formula C27H35Cl2N3O3 and a molecular weight of 520.50 g/mol. Its IUPAC name is 3-(2,6-dichloro-3,5-dimethoxyphenyl)-N,7-dimethyl-2,6-naphthyridin-1-amine;2-methylbut-2-ene;oxolane.
| Compound Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-N,7-dimethyl-2,6-naphthyridin-1-amine;2-methylbut-2-ene;oxolane |
|---|---|
| PubChem CID | 142381022 |
| Molecular Formula | C27H35Cl2N3O3 |
| Molecular Weight | 520.50 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-N,7-dimethyl-2,6-naphthyridin-1-amine;2-methylbut-2-ene;oxolane |
| SMILES | C1CCOC1.CC=C(C)C.CNc1nc(-c2c(Cl)c(OC)cc(OC)c2Cl)cc2cnc(C)cc12 |
| InChI | InChI=1S/C18H17Cl2N3O2.C5H10.C4H8O/c1-9-5-11-10(8-22-9)6-12(23-18(11)21-2)15-16(19)13(24-3)7-14(25-4)17(15)20;1-4-5(2)3;1-2-4-5-3-1/h5-8H,1-4H3,(H,21,23);4H,1-3H3;1-4H2 |
| InChIKey | HDWYOUHLXVRKJD-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.50 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|