C21H23Cl2N5O3 — CID 157302741
6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-N-methyl-2-N-[(3S,4R)-4-methyloxolan-3-yl]pyrido[3,4-d]pyrimidine-2,8-diamine (PubChem CID 157302741) has the molecular formula C21H23Cl2N5O3 and a molecular weight of 464.35 g/mol. Its IUPAC name is 6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-N-methyl-2-N-[(3S,4R)-4-methyloxolan-3-yl]pyrido[3,4-d]pyrimidine-2,8-diamine.
| Compound Name | 6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-N-methyl-2-N-[(3S,4R)-4-methyloxolan-3-yl]pyrido[3,4-d]pyrimidine-2,8-diamine |
|---|---|
| PubChem CID | 157302741 |
| Molecular Formula | C21H23Cl2N5O3 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-N-methyl-2-N-[(3S,4R)-4-methyloxolan-3-yl]pyrido[3,4-d]pyrimidine-2,8-diamine |
| SMILES | CNc1nc(-c2c(Cl)c(OC)cc(OC)c2Cl)cc2cnc(N[C@@H]3COC[C@@H]3C)nc12 |
| InChI | InChI=1S/C21H23Cl2N5O3/c1-10-8-31-9-13(10)27-21-25-7-11-5-12(26-20(24-2)19(11)28-21)16-17(22)14(29-3)6-15(30-4)18(16)23/h5-7,10,13H,8-9H2,1-4H3,(H,24,26)(H,25,27,28)/t10-,13+/m0/s1 |
| InChIKey | OWDSUSYWTDORLV-GXFFZTMASA-N |
| XLogP | 4.50 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |