C27H32Cl2N6O4 — CID 139456674
1-[[(3R,4S)-4-[[8-[[(1S)-1-cyclopropylethyl]amino]-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]amino]prop-2-en-1-ol (PubChem CID 139456674) has the molecular formula C27H32Cl2N6O4 and a molecular weight of 575.50 g/mol. Its IUPAC name is 1-[[(3R,4S)-4-[[8-[[(1S)-1-cyclopropylethyl]amino]-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]amino]prop-2-en-1-ol.
| Compound Name | 1-[[(3R,4S)-4-[[8-[[(1S)-1-cyclopropylethyl]amino]-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]amino]prop-2-en-1-ol |
|---|---|
| PubChem CID | 139456674 |
| Molecular Formula | C27H32Cl2N6O4 |
| Molecular Weight | 575.50 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | 1-[[(3R,4S)-4-[[8-[[(1S)-1-cyclopropylethyl]amino]-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]amino]prop-2-en-1-ol |
| SMILES | C=CC(O)N[C@H]1COC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)nc(N[C@@H](C)C3CC3)c2n1 |
| InChI | InChI=1S/C27H32Cl2N6O4/c1-5-21(36)32-17-11-39-12-18(17)34-27-30-10-15-8-16(22-23(28)19(37-3)9-20(38-4)24(22)29)33-26(25(15)35-27)31-13(2)14-6-7-14/h5,8-10,13-14,17-18,21,32,36H,1,6-7,11-12H2,2-4H3,(H,31,33)(H,30,34,35)/t13-,17-,18+,21?/m0/s1 |
| InChIKey | JILZKUZPBYEUAH-NHAGYWFFSA-N |
| XLogP | 4.50 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|