C26H30Cl2N6O5 — CID 167095727
1-[[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-morpholin-4-ylpyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]amino]prop-2-en-1-ol (PubChem CID 167095727) has the molecular formula C26H30Cl2N6O5 and a molecular weight of 577.47 g/mol. Its IUPAC name is 1-[[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-morpholin-4-ylpyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]amino]prop-2-en-1-ol.
| Compound Name | 1-[[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-morpholin-4-ylpyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]amino]prop-2-en-1-ol |
|---|---|
| PubChem CID | 167095727 |
| Molecular Formula | C26H30Cl2N6O5 |
| Molecular Weight | 577.47 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | 1-[[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-morpholin-4-ylpyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]amino]prop-2-en-1-ol |
| SMILES | C=CC(O)N[C@H]1COC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)nc(N3CCOCC3)c2n1 |
| InChI | InChI=1S/C26H30Cl2N6O5/c1-4-20(35)30-16-12-39-13-17(16)32-26-29-11-14-9-15(21-22(27)18(36-2)10-19(37-3)23(21)28)31-25(24(14)33-26)34-5-7-38-8-6-34/h4,9-11,16-17,20,30,35H,1,5-8,12-13H2,2-3H3,(H,29,32,33)/t16-,17+,20?/m0/s1 |
| InChIKey | SWSRBFZLZFEQRP-QJNHQHDKSA-N |
| XLogP | 3.13 |
| TPSA | 123.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|