C28H31Cl2N7O4 — CID 139456734
1-[[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-[(1-methylpyrrol-3-yl)methylamino]pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]amino]prop-2-en-1-ol (PubChem CID 139456734) has the molecular formula C28H31Cl2N7O4 and a molecular weight of 600.51 g/mol. Its IUPAC name is 1-[[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-[(1-methylpyrrol-3-yl)methylamino]pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]amino]prop-2-en-1-ol.
| Compound Name | 1-[[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-[(1-methylpyrrol-3-yl)methylamino]pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]amino]prop-2-en-1-ol |
|---|---|
| PubChem CID | 139456734 |
| Molecular Formula | C28H31Cl2N7O4 |
| Molecular Weight | 600.51 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | 1-[[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-[(1-methylpyrrol-3-yl)methylamino]pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]amino]prop-2-en-1-ol |
| SMILES | C=CC(O)N[C@H]1COC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)nc(NCc3ccn(C)c3)c2n1 |
| InChI | InChI=1S/C28H31Cl2N7O4/c1-5-22(38)33-18-13-41-14-19(18)35-28-32-11-16-8-17(23-24(29)20(39-3)9-21(40-4)25(23)30)34-27(26(16)36-28)31-10-15-6-7-37(2)12-15/h5-9,11-12,18-19,22,33,38H,1,10,13-14H2,2-4H3,(H,31,34)(H,32,35,36)/t18-,19+,22?/m0/s1 |
| InChIKey | POMSJLZQPXSXLQ-ZKTCVHQMSA-N |
| XLogP | 4.24 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|