C28H31Cl2N5O5 — CID 158436797
1-[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-[[(2R)-oxolan-2-yl]methylamino]pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]but-3-en-2-one (PubChem CID 158436797) has the molecular formula C28H31Cl2N5O5 and a molecular weight of 588.49 g/mol. Its IUPAC name is 1-[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-[[(2R)-oxolan-2-yl]methylamino]pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]but-3-en-2-one.
| Compound Name | 1-[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-[[(2R)-oxolan-2-yl]methylamino]pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 158436797 |
| Molecular Formula | C28H31Cl2N5O5 |
| Molecular Weight | 588.49 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | 1-[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-[[(2R)-oxolan-2-yl]methylamino]pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]but-3-en-2-one |
| SMILES | C=CC(=O)C[C@H]1COC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)nc(NC[C@H]3CCCO3)c2n1 |
| InChI | InChI=1S/C28H31Cl2N5O5/c1-4-17(36)8-16-13-39-14-20(16)34-28-32-11-15-9-19(23-24(29)21(37-2)10-22(38-3)25(23)30)33-27(26(15)35-28)31-12-18-6-5-7-40-18/h4,9-11,16,18,20H,1,5-8,12-14H2,2-3H3,(H,31,33)(H,32,34,35)/t16-,18+,20+/m0/s1 |
| InChIKey | UIWROGZDLBXAES-ILZDJORESA-N |
| XLogP | 5.18 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|