C27H30Cl2N4O4 — CID 149454744
1-[(3S,4R)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(ethylamino)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]but-3-en-2-one (PubChem CID 149454744) has the molecular formula C27H30Cl2N4O4 and a molecular weight of 545.47 g/mol. Its IUPAC name is 1-[(3S,4R)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(ethylamino)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]but-3-en-2-one.
| Compound Name | 1-[(3S,4R)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(ethylamino)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 149454744 |
| Molecular Formula | C27H30Cl2N4O4 |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | 1-[(3S,4R)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(ethylamino)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]but-3-en-2-one |
| SMILES | C=CC(=O)C[C@H]1CCOC[C@H]1Nc1cc2c(NCC)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C27H30Cl2N4O4/c1-5-17(34)9-15-7-8-37-14-20(15)32-23-11-18-16(13-31-23)10-19(33-27(18)30-6-2)24-25(28)21(35-3)12-22(36-4)26(24)29/h5,10-13,15,20H,1,6-9,14H2,2-4H3,(H,30,33)(H,31,32)/t15-,20-/m1/s1 |
| InChIKey | YYICFJZDQSUOPY-FOIQADDNSA-N |
| XLogP | 6.01 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|