C26H29Cl2N5O5 — CID 139385290
N-[(3S,4S)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(2-hydroxyethylamino)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]prop-2-enamide (PubChem CID 139385290) has the molecular formula C26H29Cl2N5O5 and a molecular weight of 562.45 g/mol. Its IUPAC name is N-[(3S,4S)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(2-hydroxyethylamino)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]prop-2-enamide.
| Compound Name | N-[(3S,4S)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(2-hydroxyethylamino)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 139385290 |
| Molecular Formula | C26H29Cl2N5O5 |
| Molecular Weight | 562.45 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | N-[(3S,4S)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(2-hydroxyethylamino)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCOC[C@H]1Nc1cc2c(NCCO)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C26H29Cl2N5O5/c1-4-22(35)32-16-5-8-38-13-18(16)31-21-10-15-14(12-30-21)9-17(33-26(15)29-6-7-34)23-24(27)19(36-2)11-20(37-3)25(23)28/h4,9-12,16,18,34H,1,5-8,13H2,2-3H3,(H,29,33)(H,30,31)(H,32,35)/t16-,18+/m0/s1 |
| InChIKey | FZJSTBPUVHHMAP-FUHWJXTLSA-N |
| XLogP | 3.90 |
| TPSA | 126.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|