C29H33Cl2N5O5 — CID 135180552
N-[(3S,4S)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(3-methoxypyrrolidin-1-yl)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]prop-2-enamide (PubChem CID 135180552) has the molecular formula C29H33Cl2N5O5 and a molecular weight of 602.52 g/mol. Its IUPAC name is N-[(3S,4S)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(3-methoxypyrrolidin-1-yl)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]prop-2-enamide.
| Compound Name | N-[(3S,4S)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(3-methoxypyrrolidin-1-yl)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135180552 |
| Molecular Formula | C29H33Cl2N5O5 |
| Molecular Weight | 602.52 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | N-[(3S,4S)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(3-methoxypyrrolidin-1-yl)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCOC[C@H]1Nc1cc2c(N3CCC(OC)C3)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C29H33Cl2N5O5/c1-5-25(37)34-19-7-9-41-15-21(19)33-24-11-18-16(13-32-24)10-20(35-29(18)36-8-6-17(14-36)38-2)26-27(30)22(39-3)12-23(40-4)28(26)31/h5,10-13,17,19,21H,1,6-9,14-15H2,2-4H3,(H,32,33)(H,34,37)/t17?,19-,21+/m0/s1 |
| InChIKey | NASHYINDPMXSNU-QJUSXVFHSA-N |
| XLogP | 4.72 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|