C28H32Cl2N6O5 — CID 135180214
N-[(3S,4S)-3-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-(3-methoxypyrrolidin-1-yl)pyrido[3,4-d]pyrimidin-6-yl]amino]oxan-4-yl]prop-2-enamide (PubChem CID 135180214) has the molecular formula C28H32Cl2N6O5 and a molecular weight of 603.51 g/mol. Its IUPAC name is N-[(3S,4S)-3-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-(3-methoxypyrrolidin-1-yl)pyrido[3,4-d]pyrimidin-6-yl]amino]oxan-4-yl]prop-2-enamide.
| Compound Name | N-[(3S,4S)-3-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-(3-methoxypyrrolidin-1-yl)pyrido[3,4-d]pyrimidin-6-yl]amino]oxan-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135180214 |
| Molecular Formula | C28H32Cl2N6O5 |
| Molecular Weight | 603.51 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | N-[(3S,4S)-3-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-(3-methoxypyrrolidin-1-yl)pyrido[3,4-d]pyrimidin-6-yl]amino]oxan-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCOC[C@H]1Nc1cc2c(N3CCC(OC)C3)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)nc2cn1 |
| InChI | InChI=1S/C28H32Cl2N6O5/c1-5-23(37)33-17-7-9-41-14-19(17)32-22-10-16-18(12-31-22)34-27(35-28(16)36-8-6-15(13-36)38-2)24-25(29)20(39-3)11-21(40-4)26(24)30/h5,10-12,15,17,19H,1,6-9,13-14H2,2-4H3,(H,31,32)(H,33,37)/t15?,17-,19+/m0/s1 |
| InChIKey | CPRWKJFDKHVFHZ-IYSUZNMVSA-N |
| XLogP | 4.11 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|