C31H34Cl2N8O4 — CID 135180173
N-[(3S,4R)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(oxolan-3-ylamino)-2,6-naphthyridin-3-yl]amino]-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]prop-2-enamide (PubChem CID 135180173) has the molecular formula C31H34Cl2N8O4 and a molecular weight of 653.57 g/mol. Its IUPAC name is N-[(3S,4R)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(oxolan-3-ylamino)-2,6-naphthyridin-3-yl]amino]-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3S,4R)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(oxolan-3-ylamino)-2,6-naphthyridin-3-yl]amino]-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135180173 |
| Molecular Formula | C31H34Cl2N8O4 |
| Molecular Weight | 653.57 g/mol |
| Exact Mass | 652.21 |
| IUPAC Name | N-[(3S,4R)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(oxolan-3-ylamino)-2,6-naphthyridin-3-yl]amino]-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CN(c2cnn(C)c2)C[C@H]1Nc1cc2c(NC3CCOC3)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C31H34Cl2N8O4/c1-5-27(42)38-23-15-41(19-12-35-40(2)13-19)14-22(23)37-26-9-20-17(11-34-26)8-21(39-31(20)36-18-6-7-45-16-18)28-29(32)24(43-3)10-25(44-4)30(28)33/h5,8-13,18,22-23H,1,6-7,14-16H2,2-4H3,(H,34,37)(H,36,39)(H,38,42)/t18?,22-,23+/m1/s1 |
| InChIKey | BBYLSESIWFDGNB-ZPUYXXQXSA-N |
| XLogP | 4.53 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|