C29H33Cl2N7O5 — CID 135180084
N-[(3S,4R)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(oxolan-3-ylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]-1-(oxetan-3-yl)pyrrolidin-3-yl]prop-2-enamide (PubChem CID 135180084) has the molecular formula C29H33Cl2N7O5 and a molecular weight of 630.53 g/mol. Its IUPAC name is N-[(3S,4R)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(oxolan-3-ylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]-1-(oxetan-3-yl)pyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3S,4R)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(oxolan-3-ylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]-1-(oxetan-3-yl)pyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135180084 |
| Molecular Formula | C29H33Cl2N7O5 |
| Molecular Weight | 630.53 g/mol |
| Exact Mass | 629.19 |
| IUPAC Name | N-[(3S,4R)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(oxolan-3-ylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]-1-(oxetan-3-yl)pyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CN(C2COC2)C[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)nc(NC3CCOC3)c2n1 |
| InChI | InChI=1S/C29H33Cl2N7O5/c1-4-23(39)34-19-10-38(17-13-43-14-17)11-20(19)36-29-32-9-15-7-18(24-25(30)21(40-2)8-22(41-3)26(24)31)35-28(27(15)37-29)33-16-5-6-42-12-16/h4,7-9,16-17,19-20H,1,5-6,10-14H2,2-3H3,(H,33,35)(H,34,39)(H,32,36,37)/t16?,19-,20+/m0/s1 |
| InChIKey | FFTJLCKESREORX-KHMGXFTDSA-N |
| XLogP | 3.38 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|