C27H31Cl2N7O4 — CID 135180083
N-[(3S,4R)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(oxolan-3-ylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]-1-methylpyrrolidin-3-yl]prop-2-enamide (PubChem CID 135180083) has the molecular formula C27H31Cl2N7O4 and a molecular weight of 588.50 g/mol. Its IUPAC name is N-[(3S,4R)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(oxolan-3-ylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]-1-methylpyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3S,4R)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(oxolan-3-ylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]-1-methylpyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135180083 |
| Molecular Formula | C27H31Cl2N7O4 |
| Molecular Weight | 588.50 g/mol |
| Exact Mass | 587.18 |
| IUPAC Name | N-[(3S,4R)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(oxolan-3-ylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]-1-methylpyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CN(C)C[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)nc(NC3CCOC3)c2n1 |
| InChI | InChI=1S/C27H31Cl2N7O4/c1-5-21(37)32-17-11-36(2)12-18(17)34-27-30-10-14-8-16(22-23(28)19(38-3)9-20(39-4)24(22)29)33-26(25(14)35-27)31-15-6-7-40-13-15/h5,8-10,15,17-18H,1,6-7,11-13H2,2-4H3,(H,31,33)(H,32,37)(H,30,34,35)/t15?,17-,18+/m0/s1 |
| InChIKey | GRRMJOAEHODDJC-XSRYCBBQSA-N |
| XLogP | 3.61 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|