C27H29Cl2N5O5 — CID 163908344
N-[4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(oxolan-3-ylamino)-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide (PubChem CID 163908344) has the molecular formula C27H29Cl2N5O5 and a molecular weight of 574.47 g/mol. Its IUPAC name is N-[4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(oxolan-3-ylamino)-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide.
| Compound Name | N-[4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(oxolan-3-ylamino)-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 163908344 |
| Molecular Formula | C27H29Cl2N5O5 |
| Molecular Weight | 574.47 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | N-[4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(oxolan-3-ylamino)-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1COCC1Nc1cc2c(NC3CCOC3)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C27H29Cl2N5O5/c1-4-23(35)33-19-13-39-12-18(19)32-22-8-16-14(10-30-22)7-17(34-27(16)31-15-5-6-38-11-15)24-25(28)20(36-2)9-21(37-3)26(24)29/h4,7-10,15,18-19H,1,5-6,11-13H2,2-3H3,(H,30,32)(H,31,34)(H,33,35) |
| InChIKey | QPXUOPJFGDQNFT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|