C28H29Cl2N7O4 — CID 139385670
N-[(3R,4S)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-[(1-methylpyrazol-4-yl)methylamino]-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide (PubChem CID 139385670) has the molecular formula C28H29Cl2N7O4 and a molecular weight of 598.49 g/mol. Its IUPAC name is N-[(3R,4S)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-[(1-methylpyrazol-4-yl)methylamino]-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide.
| Compound Name | N-[(3R,4S)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-[(1-methylpyrazol-4-yl)methylamino]-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 139385670 |
| Molecular Formula | C28H29Cl2N7O4 |
| Molecular Weight | 598.49 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | N-[(3R,4S)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-[(1-methylpyrazol-4-yl)methylamino]-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1COC[C@H]1Nc1cc2c(NCc3cnn(C)c3)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C28H29Cl2N7O4/c1-5-24(38)35-20-14-41-13-19(20)34-23-7-17-16(11-31-23)6-18(36-28(17)32-9-15-10-33-37(2)12-15)25-26(29)21(39-3)8-22(40-4)27(25)30/h5-8,10-12,19-20H,1,9,13-14H2,2-4H3,(H,31,34)(H,32,36)(H,35,38)/t19-,20+/m1/s1 |
| InChIKey | AJIKNPFXZFNUPB-UXHICEINSA-N |
| XLogP | 4.45 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|