C23H22Cl2N4O5 — CID 135180050
N-[(3R,4S)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-oxo-6H-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide (PubChem CID 135180050) has the molecular formula C23H22Cl2N4O5 and a molecular weight of 505.36 g/mol. Its IUPAC name is N-[(3R,4S)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-oxo-6H-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide.
| Compound Name | N-[(3R,4S)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-oxo-6H-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135180050 |
| Molecular Formula | C23H22Cl2N4O5 |
| Molecular Weight | 505.36 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | N-[(3R,4S)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-oxo-6H-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1COC[C@H]1Nc1cc2c(=O)[nH]c(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C23H22Cl2N4O5/c1-4-19(30)28-15-10-34-9-14(15)27-18-6-12-11(8-26-18)5-13(29-23(12)31)20-21(24)16(32-2)7-17(33-3)22(20)25/h4-8,14-15H,1,9-10H2,2-3H3,(H,26,27)(H,28,30)(H,29,31)/t14-,15+/m1/s1 |
| InChIKey | HHTDOZJJFFSSKQ-CABCVRRESA-N |
| XLogP | 3.40 |
| TPSA | 114.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|