C22H21Cl2N5O4 — CID 167095572
N-[(4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide (PubChem CID 167095572) has the molecular formula C22H21Cl2N5O4 and a molecular weight of 490.35 g/mol. Its IUPAC name is N-[(4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide.
| Compound Name | N-[(4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 167095572 |
| Molecular Formula | C22H21Cl2N5O4 |
| Molecular Weight | 490.35 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | N-[(4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1COC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)ncc2n1 |
| InChI | InChI=1S/C22H21Cl2N5O4/c1-4-18(30)27-14-9-33-10-15(14)29-22-26-7-11-5-12(25-8-13(11)28-22)19-20(23)16(31-2)6-17(32-3)21(19)24/h4-8,14-15H,1,9-10H2,2-3H3,(H,27,30)(H,26,28,29)/t14?,15-/m1/s1 |
| InChIKey | QKTIVIWLUVAMIG-YSSOQSIOSA-N |
| XLogP | 3.50 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|